C15H14NOY- — CID 134861512
1-benzyl-3,4,5,6-tetrahydroindol-3-id-2-one;yttrium (PubChem CID 134861512) has the molecular formula C15H14NOY- and a molecular weight of 313.19 g/mol. Its IUPAC name is 1-benzyl-3,4,5,6-tetrahydroindol-3-id-2-one;yttrium.
| Compound Name | 1-benzyl-3,4,5,6-tetrahydroindol-3-id-2-one;yttrium |
|---|---|
| PubChem CID | 134861512 |
| Molecular Formula | C15H14NOY- |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 1-benzyl-3,4,5,6-tetrahydroindol-3-id-2-one;yttrium |
| SMILES | O=C1[C-]=C2CCCC=C2N1Cc1ccccc1.[Y] |
| InChI | InChI=1S/C15H14NO.Y/c17-15-10-13-8-4-5-9-14(13)16(15)11-12-6-2-1-3-7-12;/h1-3,6-7,9H,4-5,8,11H2;/q-1; |
| InChIKey | ITQNUSZDYVWUQA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|