About 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one
1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one (PubChem CID 12827998) has the molecular formula C16H16ClNO
and a molecular weight of 273.76 g/mol. Its IUPAC name is 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one.
Molecular Properties
| Compound Name | 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one |
| PubChem CID | 12827998 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one |
| SMILES | CC1=C2CCCC(Cl)=C2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C16H16ClNO/c1-11-13-8-5-9-14(17)15(13)18(16(11)19)10-12-6-3-2-4-7-12/h2-4,6-7H,5,8-10H2,1H3 |
| InChIKey | KSNYHJNDPZIZIB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one?
The IUPAC name of 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one (CID 12827998) is 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one.
What is the SMILES notation for 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one?
The canonical SMILES for 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one is CC1=C2CCCC(Cl)=C2N(Cc2ccccc2)C1=O.
What is the InChIKey of 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one?
The InChIKey is KSNYHJNDPZIZIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClNO/c1-11-13-8-5-9-14(17)15(13)18(16(11)19)10-12-6-3-2-4-7-12/h2-4,6-7H,5,8-10H2,1H3.
What are the key properties of 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one?
1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one has a molecular weight of 273.76 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-7-chloro-3-methyl-5,6-dihydro-4H-indol-2-one is sourced from PubChem (CID 12827998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).