C38H35N3O6Si — CID 10842045
1-benzyl-3-[4-(1-benzyl-4-methyl-2,5-dioxopyrrol-3-yl)-2,5-dioxo-1-[(4-trimethylsilylphenyl)methyl]pyrrol-3-yl]-4-methylpyrrole-2,5-dione (PubChem CID 10842045) has the molecular formula C38H35N3O6Si and a molecular weight of 657.80 g/mol. Its IUPAC name is 1-benzyl-3-[4-(1-benzyl-4-methyl-2,5-dioxopyrrol-3-yl)-2,5-dioxo-1-[(4-trimethylsilylphenyl)methyl]pyrrol-3-yl]-4-methylpyrrole-2,5-dione.
| Compound Name | 1-benzyl-3-[4-(1-benzyl-4-methyl-2,5-dioxopyrrol-3-yl)-2,5-dioxo-1-[(4-trimethylsilylphenyl)methyl]pyrrol-3-yl]-4-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 10842045 |
| Molecular Formula | C38H35N3O6Si |
| Molecular Weight | 657.80 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | 1-benzyl-3-[4-(1-benzyl-4-methyl-2,5-dioxopyrrol-3-yl)-2,5-dioxo-1-[(4-trimethylsilylphenyl)methyl]pyrrol-3-yl]-4-methylpyrrole-2,5-dione |
| SMILES | CC1=C(C2=C(C3=C(C)C(=O)N(Cc4ccccc4)C3=O)C(=O)N(Cc3ccc([Si](C)(C)C)cc3)C2=O)C(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C38H35N3O6Si/c1-23-29(35(44)39(33(23)42)20-25-12-8-6-9-13-25)31-32(30-24(2)34(43)40(36(30)45)21-26-14-10-7-11-15-26)38(47)41(37(31)46)22-27-16-18-28(19-17-27)48(3,4)5/h6-19H,20-22H2,1-5H3 |
| InChIKey | WVRGDCYLMQNHEL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|