C14H28OSi — CID 12829125
(5-ethoxy-7-methylocta-2,3-dien-4-yl)-trimethylsilane (PubChem CID 12829125) has the molecular formula C14H28OSi and a molecular weight of 240.46 g/mol. Its IUPAC name is (5-ethoxy-7-methylocta-2,3-dien-4-yl)-trimethylsilane.
| Compound Name | (5-ethoxy-7-methylocta-2,3-dien-4-yl)-trimethylsilane |
|---|---|
| PubChem CID | 12829125 |
| Molecular Formula | C14H28OSi |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (5-ethoxy-7-methylocta-2,3-dien-4-yl)-trimethylsilane |
| SMILES | CC=C=C(C(CC(C)C)OCC)[Si](C)(C)C |
| InChI | InChI=1S/C14H28OSi/c1-8-10-14(16(5,6)7)13(15-9-2)11-12(3)4/h8,12-13H,9,11H2,1-7H3 |
| InChIKey | LGHKZUAABTYHGX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|