C12H22O — CID 13406636
5-ethoxy-2,7-dimethylocta-2,3-diene (PubChem CID 13406636) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 5-ethoxy-2,7-dimethylocta-2,3-diene.
| Compound Name | 5-ethoxy-2,7-dimethylocta-2,3-diene |
|---|---|
| PubChem CID | 13406636 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 5-ethoxy-2,7-dimethylocta-2,3-diene |
| SMILES | CCOC(C=C=C(C)C)CC(C)C |
| InChI | InChI=1S/C12H22O/c1-6-13-12(9-11(4)5)8-7-10(2)3/h8,11-12H,6,9H2,1-5H3 |
| InChIKey | BPPSASVEDBYHPA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |