C11H20O — CID 12571776
4-ethoxy-3,6-dimethylhepta-1,2-diene (PubChem CID 12571776) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 4-ethoxy-3,6-dimethylhepta-1,2-diene.
| Compound Name | 4-ethoxy-3,6-dimethylhepta-1,2-diene |
|---|---|
| PubChem CID | 12571776 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 4-ethoxy-3,6-dimethylhepta-1,2-diene |
| SMILES | C=C=C(C)C(CC(C)C)OCC |
| InChI | InChI=1S/C11H20O/c1-6-10(5)11(12-7-2)8-9(3)4/h9,11H,1,7-8H2,2-5H3 |
| InChIKey | KPKLUCCAEBZXGB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |