C9H14N2O3 — CID 12830
3-(hydroxymethyl)-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 12830) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(hydroxymethyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 12830 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3-(hydroxymethyl)-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2)C(=O)N1CO |
| InChI | InChI=1S/C9H14N2O3/c12-6-11-7(13)9(10-8(11)14)4-2-1-3-5-9/h12H,1-6H2,(H,10,14) |
| InChIKey | FGVDKIGUEQOVMW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|