C9H14N2O2 — CID 13423
1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 13423) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 13423 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)NC(=O)C12CCCCC2 |
| InChI | InChI=1S/C9H14N2O2/c1-11-8(13)10-7(12)9(11)5-3-2-4-6-9/h2-6H2,1H3,(H,10,12,13) |
| InChIKey | BVGOFWCNHZHTHW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|