C10H8BrCl3 — CID 12832761
1-bromo-3-(4,4,4-trichlorobut-1-en-2-yl)benzene (PubChem CID 12832761) has the molecular formula C10H8BrCl3 and a molecular weight of 314.44 g/mol. Its IUPAC name is 1-bromo-3-(4,4,4-trichlorobut-1-en-2-yl)benzene.
| Compound Name | 1-bromo-3-(4,4,4-trichlorobut-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 12832761 |
| Molecular Formula | C10H8BrCl3 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 311.89 |
| IUPAC Name | 1-bromo-3-(4,4,4-trichlorobut-1-en-2-yl)benzene |
| SMILES | C=C(CC(Cl)(Cl)Cl)c1cccc(Br)c1 |
| InChI | InChI=1S/C10H8BrCl3/c1-7(6-10(12,13)14)8-3-2-4-9(11)5-8/h2-5H,1,6H2 |
| InChIKey | JCJBPJCWRJFLSN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|