C10H9Cl2NO2 — CID 12837651
N-(2,2-dichloroethenyl)-2-hydroxy-3-methylbenzamide (PubChem CID 12837651) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is N-(2,2-dichloroethenyl)-2-hydroxy-3-methylbenzamide.
| Compound Name | N-(2,2-dichloroethenyl)-2-hydroxy-3-methylbenzamide |
|---|---|
| PubChem CID | 12837651 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | N-(2,2-dichloroethenyl)-2-hydroxy-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC=C(Cl)Cl)c1O |
| InChI | InChI=1S/C10H9Cl2NO2/c1-6-3-2-4-7(9(6)14)10(15)13-5-8(11)12/h2-5,14H,1H3,(H,13,15) |
| InChIKey | XLPZQYLHWCMBIF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |