C14H20N4O4S — CID 12837964
2-methylpropyl 2-amino-3-(dimethylsulfamoyl)benzimidazole-5-carboxylate (PubChem CID 12837964) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-methylpropyl 2-amino-3-(dimethylsulfamoyl)benzimidazole-5-carboxylate.
| Compound Name | 2-methylpropyl 2-amino-3-(dimethylsulfamoyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 12837964 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-methylpropyl 2-amino-3-(dimethylsulfamoyl)benzimidazole-5-carboxylate |
| SMILES | CC(C)COC(=O)c1ccc2nc(N)n(S(=O)(=O)N(C)C)c2c1 |
| InChI | InChI=1S/C14H20N4O4S/c1-9(2)8-22-13(19)10-5-6-11-12(7-10)18(14(15)16-11)23(20,21)17(3)4/h5-7,9H,8H2,1-4H3,(H2,15,16) |
| InChIKey | TWNKTTLXPJXTDX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |