C20H38O2Si — CID 12841786
2-(trimethylsilylmethyl)tetradeca-1,13-dien-4-yl acetate (PubChem CID 12841786) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is 2-(trimethylsilylmethyl)tetradeca-1,13-dien-4-yl acetate.
| Compound Name | 2-(trimethylsilylmethyl)tetradeca-1,13-dien-4-yl acetate |
|---|---|
| PubChem CID | 12841786 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 2-(trimethylsilylmethyl)tetradeca-1,13-dien-4-yl acetate |
| SMILES | C=CCCCCCCCCC(CC(=C)C[Si](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C20H38O2Si/c1-7-8-9-10-11-12-13-14-15-20(22-19(3)21)16-18(2)17-23(4,5)6/h7,20H,1-2,8-17H2,3-6H3 |
| InChIKey | LYXRYLKYUCFMQT-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|