C14H14ClN3O4 — CID 12848010
ethyl 4-[(3-chlorophenyl)carbamoyl]-2-methyl-3-oxo-1H-pyrazole-5-carboxylate (PubChem CID 12848010) has the molecular formula C14H14ClN3O4 and a molecular weight of 323.74 g/mol. Its IUPAC name is ethyl 4-[(3-chlorophenyl)carbamoyl]-2-methyl-3-oxo-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-[(3-chlorophenyl)carbamoyl]-2-methyl-3-oxo-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 12848010 |
| Molecular Formula | C14H14ClN3O4 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | ethyl 4-[(3-chlorophenyl)carbamoyl]-2-methyl-3-oxo-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]n(C)c(=O)c1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H14ClN3O4/c1-3-22-14(21)11-10(13(20)18(2)17-11)12(19)16-9-6-4-5-8(15)7-9/h4-7,17H,3H2,1-2H3,(H,16,19) |
| InChIKey | JHFOQVCXAGTKFG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |