C7H5ClN4O — CID 12848155
3-(3-chloropyrazin-2-yl)-5-methyl-1,2,4-oxadiazole (PubChem CID 12848155) has the molecular formula C7H5ClN4O and a molecular weight of 196.60 g/mol. Its IUPAC name is 3-(3-chloropyrazin-2-yl)-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-(3-chloropyrazin-2-yl)-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 12848155 |
| Molecular Formula | C7H5ClN4O |
| Molecular Weight | 196.60 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 3-(3-chloropyrazin-2-yl)-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2nccnc2Cl)no1 |
| InChI | InChI=1S/C7H5ClN4O/c1-4-11-7(12-13-4)5-6(8)10-3-2-9-5/h2-3H,1H3 |
| InChIKey | WFOKVAOPGBIBLP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.60 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |