C6H4N4O — CID 3062315
3-pyrazin-2-yl-1,2,4-oxadiazole (PubChem CID 3062315) has the molecular formula C6H4N4O and a molecular weight of 148.12 g/mol. Its IUPAC name is 3-pyrazin-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-pyrazin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 3062315 |
| Molecular Formula | C6H4N4O |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 3-pyrazin-2-yl-1,2,4-oxadiazole |
| SMILES | c1cnc(-c2ncon2)cn1 |
| InChI | InChI=1S/C6H4N4O/c1-2-8-5(3-7-1)6-9-4-11-10-6/h1-4H |
| InChIKey | UMLFDKVERILJEA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |