C13H20N2O5S — CID 128514047
N-(2,5-dioxopyrrolidin-3-yl)-2-(1,1-dioxothian-3-yl)-N-ethylacetamide (PubChem CID 128514047) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-(2,5-dioxopyrrolidin-3-yl)-2-(1,1-dioxothian-3-yl)-N-ethylacetamide.
| Compound Name | N-(2,5-dioxopyrrolidin-3-yl)-2-(1,1-dioxothian-3-yl)-N-ethylacetamide |
|---|---|
| PubChem CID | 128514047 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-(2,5-dioxopyrrolidin-3-yl)-2-(1,1-dioxothian-3-yl)-N-ethylacetamide |
| SMILES | CCN(C(=O)CC1CCCS(=O)(=O)C1)C1CC(=O)NC1=O |
| InChI | InChI=1S/C13H20N2O5S/c1-2-15(10-7-11(16)14-13(10)18)12(17)6-9-4-3-5-21(19,20)8-9/h9-10H,2-8H2,1H3,(H,14,16,18) |
| InChIKey | PBYCRFROOCVTJK-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|