C22H25NO2 — CID 12852034
[1-(1-hydroxyhexan-2-yl)-2-methylindol-3-yl]-phenylmethanone (PubChem CID 12852034) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is [1-(1-hydroxyhexan-2-yl)-2-methylindol-3-yl]-phenylmethanone.
| Compound Name | [1-(1-hydroxyhexan-2-yl)-2-methylindol-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 12852034 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | [1-(1-hydroxyhexan-2-yl)-2-methylindol-3-yl]-phenylmethanone |
| SMILES | CCCCC(CO)n1c(C)c(C(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H25NO2/c1-3-4-12-18(15-24)23-16(2)21(19-13-8-9-14-20(19)23)22(25)17-10-6-5-7-11-17/h5-11,13-14,18,24H,3-4,12,15H2,1-2H3 |
| InChIKey | BKYXHOUUGVLNOW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |