C22H25NOS — CID 70526821
[1-(1-ethylsulfanylbutyl)-2-methylindol-3-yl]-phenylmethanone (PubChem CID 70526821) has the molecular formula C22H25NOS and a molecular weight of 351.52 g/mol. Its IUPAC name is [1-(1-ethylsulfanylbutyl)-2-methylindol-3-yl]-phenylmethanone.
| Compound Name | [1-(1-ethylsulfanylbutyl)-2-methylindol-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 70526821 |
| Molecular Formula | C22H25NOS |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [1-(1-ethylsulfanylbutyl)-2-methylindol-3-yl]-phenylmethanone |
| SMILES | CCCC(SCC)n1c(C)c(C(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H25NOS/c1-4-11-20(25-5-2)23-16(3)21(18-14-9-10-15-19(18)23)22(24)17-12-7-6-8-13-17/h6-10,12-15,20H,4-5,11H2,1-3H3 |
| InChIKey | RHPCFFBXGFKSQN-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |