C26H25NO2S — CID 70526149
[1-[1-(benzenesulfinyl)butyl]-2-methylindol-3-yl]-phenylmethanone (PubChem CID 70526149) has the molecular formula C26H25NO2S and a molecular weight of 415.56 g/mol. Its IUPAC name is [1-[1-(benzenesulfinyl)butyl]-2-methylindol-3-yl]-phenylmethanone.
| Compound Name | [1-[1-(benzenesulfinyl)butyl]-2-methylindol-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 70526149 |
| Molecular Formula | C26H25NO2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [1-[1-(benzenesulfinyl)butyl]-2-methylindol-3-yl]-phenylmethanone |
| SMILES | CCCC(n1c(C)c(C(=O)c2ccccc2)c2ccccc21)S(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25NO2S/c1-3-12-24(30(29)21-15-8-5-9-16-21)27-19(2)25(22-17-10-11-18-23(22)27)26(28)20-13-6-4-7-14-20/h4-11,13-18,24H,3,12H2,1-2H3 |
| InChIKey | JPKKTZPAWAGQOR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |