C12H20N2O3S — CID 128567095
2-cyclohexyl-N-(4-methyl-1,2-oxazol-3-yl)ethanesulfonamide (PubChem CID 128567095) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-cyclohexyl-N-(4-methyl-1,2-oxazol-3-yl)ethanesulfonamide.
| Compound Name | 2-cyclohexyl-N-(4-methyl-1,2-oxazol-3-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 128567095 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-cyclohexyl-N-(4-methyl-1,2-oxazol-3-yl)ethanesulfonamide |
| SMILES | Cc1conc1NS(=O)(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C12H20N2O3S/c1-10-9-17-13-12(10)14-18(15,16)8-7-11-5-3-2-4-6-11/h9,11H,2-8H2,1H3,(H,13,14) |
| InChIKey | VROFCMDTALIKPG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |