C15H18ClN3O2S — CID 128587534
4-[3-(3-chlorophenyl)azetidin-1-yl]sulfonyl-1,3,5-trimethylpyrazole (PubChem CID 128587534) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 4-[3-(3-chlorophenyl)azetidin-1-yl]sulfonyl-1,3,5-trimethylpyrazole.
| Compound Name | 4-[3-(3-chlorophenyl)azetidin-1-yl]sulfonyl-1,3,5-trimethylpyrazole |
|---|---|
| PubChem CID | 128587534 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-[3-(3-chlorophenyl)azetidin-1-yl]sulfonyl-1,3,5-trimethylpyrazole |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CC(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-10-15(11(2)18(3)17-10)22(20,21)19-8-13(9-19)12-5-4-6-14(16)7-12/h4-7,13H,8-9H2,1-3H3 |
| InChIKey | TTYMWMKDYHXUIU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |