C21H31N5O2S — CID 69146873
(1S)-1-phenyl-3-[5-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propan-1-amine (PubChem CID 69146873) has the molecular formula C21H31N5O2S and a molecular weight of 417.58 g/mol. Its IUPAC name is (1S)-1-phenyl-3-[5-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propan-1-amine.
| Compound Name | (1S)-1-phenyl-3-[5-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 69146873 |
| Molecular Formula | C21H31N5O2S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (1S)-1-phenyl-3-[5-(1,3,5-trimethylpyrazol-4-yl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propan-1-amine |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CC2CN(CC[C@H](N)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C21H31N5O2S/c1-15-21(16(2)24(3)23-15)29(27,28)26-13-18-11-25(12-19(18)14-26)10-9-20(22)17-7-5-4-6-8-17/h4-8,18-20H,9-14,22H2,1-3H3/t18?,19?,20-/m0/s1 |
| InChIKey | GWDPVKIIZCLKBF-MHJFOBGBSA-N |
| XLogP | 1.68 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |