C22H27N3O — CID 69148788
[2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone (PubChem CID 69148788) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone.
| Compound Name | [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 69148788 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-phenylmethanone |
| SMILES | N[C@@H](CCN1CC2CN(C(=O)c3ccccc3)CC2C1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O/c23-21(17-7-3-1-4-8-17)11-12-24-13-19-15-25(16-20(19)14-24)22(26)18-9-5-2-6-10-18/h1-10,19-21H,11-16,23H2/t19?,20?,21-/m0/s1 |
| InChIKey | ABFZPERDUMZBKW-CBNMVNINSA-N |
| XLogP | 2.78 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |