C22H25Cl2N3O — CID 69147102
[2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dichlorophenyl)methanone (PubChem CID 69147102) has the molecular formula C22H25Cl2N3O and a molecular weight of 418.37 g/mol. Its IUPAC name is [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dichlorophenyl)methanone.
| Compound Name | [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 69147102 |
| Molecular Formula | C22H25Cl2N3O |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dichlorophenyl)methanone |
| SMILES | N[C@@H](CCN1CC2CN(C(=O)c3c(Cl)cccc3Cl)CC2C1)c1ccccc1 |
| InChI | InChI=1S/C22H25Cl2N3O/c23-18-7-4-8-19(24)21(18)22(28)27-13-16-11-26(12-17(16)14-27)10-9-20(25)15-5-2-1-3-6-15/h1-8,16-17,20H,9-14,25H2/t16?,17?,20-/m0/s1 |
| InChIKey | SOPVPVAPZLVFQX-UHYCVJNDSA-N |
| XLogP | 4.09 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |