C24H27N3OS — CID 69149957
[2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-benzothiophen-3-yl)methanone (PubChem CID 69149957) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-benzothiophen-3-yl)methanone.
| Compound Name | [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-benzothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 69149957 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1-benzothiophen-3-yl)methanone |
| SMILES | N[C@@H](CCN1CC2CN(C(=O)c3csc4ccccc34)CC2C1)c1ccccc1 |
| InChI | InChI=1S/C24H27N3OS/c25-22(17-6-2-1-3-7-17)10-11-26-12-18-14-27(15-19(18)13-26)24(28)21-16-29-23-9-5-4-8-20(21)23/h1-9,16,18-19,22H,10-15,25H2/t18?,19?,22-/m0/s1 |
| InChIKey | FYNFJTUZDGNBOC-AJTFCVKESA-N |
| XLogP | 4.00 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |