C23H27F3N4O — CID 69149268
[2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-amino-6-(trifluoromethyl)phenyl]methanone (PubChem CID 69149268) has the molecular formula C23H27F3N4O and a molecular weight of 432.49 g/mol. Its IUPAC name is [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-amino-6-(trifluoromethyl)phenyl]methanone.
| Compound Name | [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-amino-6-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 69149268 |
| Molecular Formula | C23H27F3N4O |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | [2-[(3S)-3-amino-3-phenylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-amino-6-(trifluoromethyl)phenyl]methanone |
| SMILES | Nc1cccc(C(F)(F)F)c1C(=O)N1CC2CN(CC[C@H](N)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C23H27F3N4O/c24-23(25,26)18-7-4-8-20(28)21(18)22(31)30-13-16-11-29(12-17(16)14-30)10-9-19(27)15-5-2-1-3-6-15/h1-8,16-17,19H,9-14,27-28H2/t16?,17?,19-/m0/s1 |
| InChIKey | RTSNVLXUSXUWOX-TVPLGVNVSA-N |
| XLogP | 3.38 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|