C30H39F3N4O4 — CID 11592286
N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(dimethylamino)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 11592286) has the molecular formula C30H39F3N4O4 and a molecular weight of 576.66 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(dimethylamino)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(dimethylamino)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11592286 |
| Molecular Formula | C30H39F3N4O4 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-(dimethylamino)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cccc(C)c1C(=O)N1CC2CN(CCC(NC(=O)CN(C)C)c3ccccc3)C[C@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H38N4O2.C2HF3O2/c1-20-9-8-10-21(2)27(20)28(34)32-17-23-15-31(16-24(23)18-32)14-13-25(22-11-6-5-7-12-22)29-26(33)19-30(3)4;3-2(4,5)1(6)7/h5-12,23-25H,13-19H2,1-4H3,(H,29,33);(H,6,7)/t23-,24?,25?;/m0./s1 |
| InChIKey | BSYLYSZPBZVBHW-KIDQDMSLSA-N |
| XLogP | 3.75 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |