C30H36N4O2 — CID 11505313
N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-1-methylpyrrole-2-carboxamide (PubChem CID 11505313) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 11505313 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cc1cccc(C)c1C(=O)N1CC2CN(CCC(NC(=O)c3cccn3C)c3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C30H36N4O2/c1-21-9-7-10-22(2)28(21)30(36)34-19-24-17-33(18-25(24)20-34)16-14-26(23-11-5-4-6-12-23)31-29(35)27-13-8-15-32(27)3/h4-13,15,24-26H,14,16-20H2,1-3H3,(H,31,35)/t24-,25?,26?/m0/s1 |
| InChIKey | ARHNXYAHXJPLRC-IHSPPPAMSA-N |
| XLogP | 4.21 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |