C28H37N3O3 — CID 69147126
N-[(1S)-3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-hydroxy-2-methylpropanamide (PubChem CID 69147126) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[(1S)-3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-hydroxy-2-methylpropanamide.
| Compound Name | N-[(1S)-3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 69147126 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[(1S)-3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-2-hydroxy-2-methylpropanamide |
| SMILES | Cc1cccc(C)c1C(=O)N1CC2CN(CC[C@H](NC(=O)C(C)(C)O)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C28H37N3O3/c1-19-9-8-10-20(2)25(19)26(32)31-17-22-15-30(16-23(22)18-31)14-13-24(21-11-6-5-7-12-21)29-27(33)28(3,4)34/h5-12,22-24,34H,13-18H2,1-4H3,(H,29,33)/t22?,23?,24-/m0/s1 |
| InChIKey | TVKNVSMMFXGHON-VHYCJAOWSA-N |
| XLogP | 3.33 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |