C30H35N3OS — CID 89068637
(2,6-dimethylphenyl)-[2-[(3S)-3-phenyl-3-(phenylsulfanylamino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 89068637) has the molecular formula C30H35N3OS and a molecular weight of 485.70 g/mol. Its IUPAC name is (2,6-dimethylphenyl)-[2-[(3S)-3-phenyl-3-(phenylsulfanylamino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | (2,6-dimethylphenyl)-[2-[(3S)-3-phenyl-3-(phenylsulfanylamino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 89068637 |
| Molecular Formula | C30H35N3OS |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (2,6-dimethylphenyl)-[2-[(3S)-3-phenyl-3-(phenylsulfanylamino)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1cccc(C)c1C(=O)N1CC2CN(CC[C@H](NSc3ccccc3)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C30H35N3OS/c1-22-10-9-11-23(2)29(22)30(34)33-20-25-18-32(19-26(25)21-33)17-16-28(24-12-5-3-6-13-24)31-35-27-14-7-4-8-15-27/h3-15,25-26,28,31H,16-21H2,1-2H3/t25?,26?,28-/m0/s1 |
| InChIKey | FGUWPLAELTYFJF-ZRZZZMTFSA-N |
| XLogP | 5.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|