C32H37N3O4S — CID 73003293
N-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4-methylsulfonylbenzamide (PubChem CID 73003293) has the molecular formula C32H37N3O4S and a molecular weight of 559.73 g/mol. Its IUPAC name is N-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 73003293 |
| Molecular Formula | C32H37N3O4S |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | N-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]-4-methylsulfonylbenzamide |
| SMILES | Cc1cccc(C)c1C(=O)N1CC2CN(CCC(NC(=O)c3ccc(S(C)(=O)=O)cc3)c3ccccc3)CC2C1 |
| InChI | InChI=1S/C32H37N3O4S/c1-22-8-7-9-23(2)30(22)32(37)35-20-26-18-34(19-27(26)21-35)17-16-29(24-10-5-4-6-11-24)33-31(36)25-12-14-28(15-13-25)40(3,38)39/h4-15,26-27,29H,16-21H2,1-3H3,(H,33,36) |
| InChIKey | QRKKFYKRTJXOCP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |