C23H30N4O — CID 68580342
[2-[(3S)-3-amino-3-pyridin-2-ylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethylphenyl)methanone (PubChem CID 68580342) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is [2-[(3S)-3-amino-3-pyridin-2-ylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethylphenyl)methanone.
| Compound Name | [2-[(3S)-3-amino-3-pyridin-2-ylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 68580342 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [2-[(3S)-3-amino-3-pyridin-2-ylpropyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethylphenyl)methanone |
| SMILES | Cc1cccc(C)c1C(=O)N1CC2CN(CC[C@H](N)c3ccccn3)CC2C1 |
| InChI | InChI=1S/C23H30N4O/c1-16-6-5-7-17(2)22(16)23(28)27-14-18-12-26(13-19(18)15-27)11-9-20(24)21-8-3-4-10-25-21/h3-8,10,18-20H,9,11-15,24H2,1-2H3/t18?,19?,20-/m0/s1 |
| InChIKey | IPZPEMPPZFSPSX-MHJFOBGBSA-N |
| XLogP | 2.79 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |