C26H35N3O — CID 68580565
[2-(3-amino-3-phenylpropyl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethylphenyl)methanone (PubChem CID 68580565) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is [2-(3-amino-3-phenylpropyl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethylphenyl)methanone.
| Compound Name | [2-(3-amino-3-phenylpropyl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 68580565 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | [2-(3-amino-3-phenylpropyl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethylphenyl)methanone |
| SMILES | Cc1cccc(C)c1C(=O)N1CC2(C)CN(CCC(N)c3ccccc3)CC2(C)C1 |
| InChI | InChI=1S/C26H35N3O/c1-19-9-8-10-20(2)23(19)24(30)29-17-25(3)15-28(16-26(25,4)18-29)14-13-22(27)21-11-6-5-7-12-21/h5-12,22H,13-18,27H2,1-4H3 |
| InChIKey | QGCOPXZBZCVCOS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |