C32H43N3O2 — CID 90851082
N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide (PubChem CID 90851082) has the molecular formula C32H43N3O2 and a molecular weight of 501.72 g/mol. Its IUPAC name is N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 90851082 |
| Molecular Formula | C32H43N3O2 |
| Molecular Weight | 501.72 g/mol |
| Exact Mass | 501.34 |
| IUPAC Name | N-[3-[(3aS)-5-(2,6-dimethylbenzoyl)-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1-phenylpropyl]cyclopentanecarboxamide |
| SMILES | Cc1cccc(C)c1C(=O)N1CC2(C)CN(CCC(NC(=O)C3CCCC3)c3ccccc3)C[C@@]2(C)C1 |
| InChI | InChI=1S/C32H43N3O2/c1-23-11-10-12-24(2)28(23)30(37)35-21-31(3)19-34(20-32(31,4)22-35)18-17-27(25-13-6-5-7-14-25)33-29(36)26-15-8-9-16-26/h5-7,10-14,26-27H,8-9,15-22H2,1-4H3,(H,33,36)/t27?,31-,32?/m0/s1 |
| InChIKey | JSLSJEGYBLGLDI-IUEVIEPZSA-N |
| XLogP | 5.53 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |