C13H13N5OS — CID 128599405
3-(5-methyl-1,3-thiazol-2-yl)-5-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)-1,2,4-oxadiazole (PubChem CID 128599405) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is 3-(5-methyl-1,3-thiazol-2-yl)-5-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(5-methyl-1,3-thiazol-2-yl)-5-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 128599405 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-(5-methyl-1,3-thiazol-2-yl)-5-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)-1,2,4-oxadiazole |
| SMILES | Cc1cnc(-c2noc(C3CCn4cncc4C3)n2)s1 |
| InChI | InChI=1S/C13H13N5OS/c1-8-5-15-13(20-8)11-16-12(19-17-11)9-2-3-18-7-14-6-10(18)4-9/h5-7,9H,2-4H2,1H3 |
| InChIKey | VWHGTRXINCHWOE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |