C15H11F3N4O — CID 75476895
5-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole (PubChem CID 75476895) has the molecular formula C15H11F3N4O and a molecular weight of 320.27 g/mol. Its IUPAC name is 5-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 75476895 |
| Molecular Formula | C15H11F3N4O |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl)-3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazole |
| SMILES | Fc1cc(-c2noc(C3CCn4cncc4C3)n2)cc(F)c1F |
| InChI | InChI=1S/C15H11F3N4O/c16-11-4-9(5-12(17)13(11)18)14-20-15(23-21-14)8-1-2-22-7-19-6-10(22)3-8/h4-8H,1-3H2 |
| InChIKey | JGTUMRKVBTYUSX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|