C17H25N3O3 — CID 128611490
N-[(5-carbamoyloxolan-2-yl)methyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carboxamide (PubChem CID 128611490) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[(5-carbamoyloxolan-2-yl)methyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carboxamide.
| Compound Name | N-[(5-carbamoyloxolan-2-yl)methyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carboxamide |
|---|---|
| PubChem CID | 128611490 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-[(5-carbamoyloxolan-2-yl)methyl]-4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carboxamide |
| SMILES | NC(=O)C1CCC(CNC(=O)N2CC3C4C=CC(CC4)C3C2)O1 |
| InChI | InChI=1S/C17H25N3O3/c18-16(21)15-6-5-12(23-15)7-19-17(22)20-8-13-10-1-2-11(4-3-10)14(13)9-20/h1-2,10-15H,3-9H2,(H2,18,21)(H,19,22) |
| InChIKey | CGLDKXGISRWUCS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|