C17H19ClO5S — CID 12861796
1-butyl-3,6-dimethyl-[1]benzothiolo[2,3-c]pyran-2-ium perchlorate (PubChem CID 12861796) has the molecular formula C17H19ClO5S and a molecular weight of 370.85 g/mol. Its IUPAC name is 1-butyl-3,6-dimethyl-[1]benzothiolo[2,3-c]pyran-2-ium perchlorate.
| Compound Name | 1-butyl-3,6-dimethyl-[1]benzothiolo[2,3-c]pyran-2-ium perchlorate |
|---|---|
| PubChem CID | 12861796 |
| Molecular Formula | C17H19ClO5S |
| Molecular Weight | 370.85 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 1-butyl-3,6-dimethyl-[1]benzothiolo[2,3-c]pyran-2-ium perchlorate |
| SMILES | CCCCc1[o+]c(C)cc2c1sc1ccc(C)cc12.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H19OS.ClHO4/c1-4-5-6-15-17-14(10-12(3)18-15)13-9-11(2)7-8-16(13)19-17;2-1(3,4)5/h7-10H,4-6H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | OXZXWMSCYMFWCN-UHFFFAOYSA-M |
| XLogP | 1.13 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.85 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|