C15H16NS+ — CID 158383923
1-ethyl-2,6-dimethyl-[1]benzothiolo[2,3-c]pyridin-2-ium (PubChem CID 158383923) has the molecular formula C15H16NS+ and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-ethyl-2,6-dimethyl-[1]benzothiolo[2,3-c]pyridin-2-ium.
| Compound Name | 1-ethyl-2,6-dimethyl-[1]benzothiolo[2,3-c]pyridin-2-ium |
|---|---|
| PubChem CID | 158383923 |
| Molecular Formula | C15H16NS+ |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-ethyl-2,6-dimethyl-[1]benzothiolo[2,3-c]pyridin-2-ium |
| SMILES | CCc1c2sc3ccc(C)cc3c2cc[n+]1C |
| InChI | InChI=1S/C15H16NS/c1-4-13-15-11(7-8-16(13)3)12-9-10(2)5-6-14(12)17-15/h5-9H,4H2,1-3H3/q+1 |
| InChIKey | ARHXBMYOWDYBIR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|