C13H14NS2+ — CID 159830070
12-ethyl-5,11-dimethyl-3,7-dithia-11-azoniatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene (PubChem CID 159830070) has the molecular formula C13H14NS2+ and a molecular weight of 248.40 g/mol. Its IUPAC name is 12-ethyl-5,11-dimethyl-3,7-dithia-11-azoniatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene.
| Compound Name | 12-ethyl-5,11-dimethyl-3,7-dithia-11-azoniatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
|---|---|
| PubChem CID | 159830070 |
| Molecular Formula | C13H14NS2+ |
| Molecular Weight | 248.40 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 12-ethyl-5,11-dimethyl-3,7-dithia-11-azoniatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
| SMILES | CCc1c2c(cc[n+]1C)sc1c(C)csc12 |
| InChI | InChI=1S/C13H14NS2/c1-4-9-11-10(5-6-14(9)3)16-12-8(2)7-15-13(11)12/h5-7H,4H2,1-3H3/q+1 |
| InChIKey | WHSHOJRVXGYNII-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|