C17H20ClN3O3 — CID 128638791
N-(5-chloro-2-propan-2-yloxy-3-pyridinyl)-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-2-carboxamide (PubChem CID 128638791) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is N-(5-chloro-2-propan-2-yloxy-3-pyridinyl)-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-2-carboxamide.
| Compound Name | N-(5-chloro-2-propan-2-yloxy-3-pyridinyl)-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-2-carboxamide |
|---|---|
| PubChem CID | 128638791 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-(5-chloro-2-propan-2-yloxy-3-pyridinyl)-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-2-carboxamide |
| SMILES | CC(C)Oc1ncc(Cl)cc1NC(=O)N1CC2C3C=CC(O3)C2C1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-9(2)23-16-13(5-10(18)6-19-16)20-17(22)21-7-11-12(8-21)15-4-3-14(11)24-15/h3-6,9,11-12,14-15H,7-8H2,1-2H3,(H,20,22) |
| InChIKey | OWQZYYDKDITGTP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|