C19H25N3O2 — CID 128735144
N-[(4-tert-butyl-3-pyridinyl)methyl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-2-carboxamide (PubChem CID 128735144) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[(4-tert-butyl-3-pyridinyl)methyl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-2-carboxamide.
| Compound Name | N-[(4-tert-butyl-3-pyridinyl)methyl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-2-carboxamide |
|---|---|
| PubChem CID | 128735144 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N-[(4-tert-butyl-3-pyridinyl)methyl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole-2-carboxamide |
| SMILES | CC(C)(C)c1ccncc1CNC(=O)N1CC2C3C=CC(O3)C2C1 |
| InChI | InChI=1S/C19H25N3O2/c1-19(2,3)15-6-7-20-8-12(15)9-21-18(23)22-10-13-14(11-22)17-5-4-16(13)24-17/h4-8,13-14,16-17H,9-11H2,1-3H3,(H,21,23) |
| InChIKey | JUDFSWNASGGSGA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|