About N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide
N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide (PubChem CID 128683674) has the molecular formula C19H28N2O3S
and a molecular weight of 364.51 g/mol. Its IUPAC name is N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide.
Molecular Properties
| Compound Name | N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide |
| PubChem CID | 128683674 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NCc1ccc(C2CCCCC2)cc1)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C19H28N2O3S/c22-19(21-11-4-13-25(23,24)14-12-21)20-15-16-7-9-18(10-8-16)17-5-2-1-3-6-17/h7-10,17H,1-6,11-15H2,(H,20,22) |
| InChIKey | QPCGTOQVCBMBAY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide?
The IUPAC name of N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide (CID 128683674) is N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide.
What is the SMILES notation for N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide?
The canonical SMILES for N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide is O=C(NCc1ccc(C2CCCCC2)cc1)N1CCCS(=O)(=O)CC1.
What is the InChIKey of N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide?
The InChIKey is QPCGTOQVCBMBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O3S/c22-19(21-11-4-13-25(23,24)14-12-21)20-15-16-7-9-18(10-8-16)17-5-2-1-3-6-17/h7-10,17H,1-6,11-15H2,(H,20,22).
What are the key properties of N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide?
N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide has a molecular weight of 364.51 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-cyclohexylphenyl)methyl]-1,1-dioxo-1,4-thiazepane-4-carboxamide is sourced from PubChem (CID 128683674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).