C21H24INO3 — CID 12872436
8,8-dimethyl-3,3-diphenyl-1,4-dioxa-8-azoniaspiro[4.5]decan-2-one iodide (PubChem CID 12872436) has the molecular formula C21H24INO3 and a molecular weight of 465.33 g/mol. Its IUPAC name is 8,8-dimethyl-3,3-diphenyl-1,4-dioxa-8-azoniaspiro[4.5]decan-2-one iodide.
| Compound Name | 8,8-dimethyl-3,3-diphenyl-1,4-dioxa-8-azoniaspiro[4.5]decan-2-one iodide |
|---|---|
| PubChem CID | 12872436 |
| Molecular Formula | C21H24INO3 |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 8,8-dimethyl-3,3-diphenyl-1,4-dioxa-8-azoniaspiro[4.5]decan-2-one iodide |
| SMILES | C[N+]1(C)CCC2(CC1)OC(=O)C(c1ccccc1)(c1ccccc1)O2.[I-] |
| InChI | InChI=1S/C21H24NO3.HI/c1-22(2)15-13-20(14-16-22)24-19(23)21(25-20,17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-12H,13-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FBPHTHKZWFXRBN-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|