C15H18ClNO4 — CID 128738839
[3-(4-chlorophenoxy)pyrrolidin-1-yl]-(3-hydroxyoxolan-3-yl)methanone (PubChem CID 128738839) has the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. Its IUPAC name is [3-(4-chlorophenoxy)pyrrolidin-1-yl]-(3-hydroxyoxolan-3-yl)methanone.
| Compound Name | [3-(4-chlorophenoxy)pyrrolidin-1-yl]-(3-hydroxyoxolan-3-yl)methanone |
|---|---|
| PubChem CID | 128738839 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [3-(4-chlorophenoxy)pyrrolidin-1-yl]-(3-hydroxyoxolan-3-yl)methanone |
| SMILES | O=C(N1CCC(Oc2ccc(Cl)cc2)C1)C1(O)CCOC1 |
| InChI | InChI=1S/C15H18ClNO4/c16-11-1-3-12(4-2-11)21-13-5-7-17(9-13)14(18)15(19)6-8-20-10-15/h1-4,13,19H,5-10H2 |
| InChIKey | LAPQGUZPKYKKEF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |