C13H18BrNO3S — CID 128776482
3-bromo-N-[(2S,3R)-2-ethyloxolan-3-yl]-5-methylbenzenesulfonamide (PubChem CID 128776482) has the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. Its IUPAC name is 3-bromo-N-[(2S,3R)-2-ethyloxolan-3-yl]-5-methylbenzenesulfonamide.
| Compound Name | 3-bromo-N-[(2S,3R)-2-ethyloxolan-3-yl]-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 128776482 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 3-bromo-N-[(2S,3R)-2-ethyloxolan-3-yl]-5-methylbenzenesulfonamide |
| SMILES | CC[C@@H]1OCC[C@H]1NS(=O)(=O)c1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C13H18BrNO3S/c1-3-13-12(4-5-18-13)15-19(16,17)11-7-9(2)6-10(14)8-11/h6-8,12-13,15H,3-5H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | VEVQINHWQZCFMQ-OLZOCXBDSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |