C13H18BrN3O2 — CID 164631272
1-(5-bromo-2-methyl-3-pyridinyl)-3-[(2R,3S)-2-ethyloxolan-3-yl]urea (PubChem CID 164631272) has the molecular formula C13H18BrN3O2 and a molecular weight of 328.21 g/mol. Its IUPAC name is 1-(5-bromo-2-methyl-3-pyridinyl)-3-[(2R,3S)-2-ethyloxolan-3-yl]urea.
| Compound Name | 1-(5-bromo-2-methyl-3-pyridinyl)-3-[(2R,3S)-2-ethyloxolan-3-yl]urea |
|---|---|
| PubChem CID | 164631272 |
| Molecular Formula | C13H18BrN3O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 1-(5-bromo-2-methyl-3-pyridinyl)-3-[(2R,3S)-2-ethyloxolan-3-yl]urea |
| SMILES | CC[C@H]1OCC[C@@H]1NC(=O)Nc1cc(Br)cnc1C |
| InChI | InChI=1S/C13H18BrN3O2/c1-3-12-10(4-5-19-12)16-13(18)17-11-6-9(14)7-15-8(11)2/h6-7,10,12H,3-5H2,1-2H3,(H2,16,17,18)/t10-,12+/m0/s1 |
| InChIKey | QOSQFNNXBWUPIF-CMPLNLGQSA-N |
| XLogP | 2.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |