C18H23N3O2 — CID 128790712
N-(1-ethyl-2-oxo-3-pyridinyl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carboxamide (PubChem CID 128790712) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(1-ethyl-2-oxo-3-pyridinyl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carboxamide.
| Compound Name | N-(1-ethyl-2-oxo-3-pyridinyl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carboxamide |
|---|---|
| PubChem CID | 128790712 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-(1-ethyl-2-oxo-3-pyridinyl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carboxamide |
| SMILES | CCn1cccc(NC(=O)N2CC3C4C=CC(CC4)C3C2)c1=O |
| InChI | InChI=1S/C18H23N3O2/c1-2-20-9-3-4-16(17(20)22)19-18(23)21-10-14-12-5-6-13(8-7-12)15(14)11-21/h3-6,9,12-15H,2,7-8,10-11H2,1H3,(H,19,23) |
| InChIKey | WWDXYYTWWRXUTF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|