C16H19F3N4O — CID 128625396
(2R,6S)-N-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxamide (PubChem CID 128625396) has the molecular formula C16H19F3N4O and a molecular weight of 340.35 g/mol. Its IUPAC name is (2R,6S)-N-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxamide.
| Compound Name | (2R,6S)-N-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxamide |
|---|---|
| PubChem CID | 128625396 |
| Molecular Formula | C16H19F3N4O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2R,6S)-N-[1-ethyl-5-(trifluoromethyl)pyrazol-4-yl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-4-carboxamide |
| SMILES | CCn1ncc(NC(=O)N2C[C@@H]3C4C=CC(C4)[C@@H]3C2)c1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N4O/c1-2-23-14(16(17,18)19)13(6-20-23)21-15(24)22-7-11-9-3-4-10(5-9)12(11)8-22/h3-4,6,9-12H,2,5,7-8H2,1H3,(H,21,24)/t9?,10?,11-,12+ |
| InChIKey | JDTKJUITSYRYQX-CAODYFQJSA-N |
| XLogP | 3.21 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|