C15H26N4O2 — CID 136542623
N-(1-butyl-5-methylpyrazol-4-yl)-3-(2-hydroxypropan-2-yl)azetidine-1-carboxamide (PubChem CID 136542623) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-(1-butyl-5-methylpyrazol-4-yl)-3-(2-hydroxypropan-2-yl)azetidine-1-carboxamide.
| Compound Name | N-(1-butyl-5-methylpyrazol-4-yl)-3-(2-hydroxypropan-2-yl)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 136542623 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-(1-butyl-5-methylpyrazol-4-yl)-3-(2-hydroxypropan-2-yl)azetidine-1-carboxamide |
| SMILES | CCCCn1ncc(NC(=O)N2CC(C(C)(C)O)C2)c1C |
| InChI | InChI=1S/C15H26N4O2/c1-5-6-7-19-11(2)13(8-16-19)17-14(20)18-9-12(10-18)15(3,4)21/h8,12,21H,5-7,9-10H2,1-4H3,(H,17,20) |
| InChIKey | UPNMZPRNQIYXCS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |